C17H25FN4OS — CID 111578568
N-[2-[[ethylamino-[2-(2-fluorophenyl)sulfanylethylamino]methylidene]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111578568) has the molecular formula C17H25FN4OS and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2-[[ethylamino-[2-(2-fluorophenyl)sulfanylethylamino]methylidene]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[ethylamino-[2-(2-fluorophenyl)sulfanylethylamino]methylidene]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111578568 |
| Molecular Formula | C17H25FN4OS |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-[2-[[ethylamino-[2-(2-fluorophenyl)sulfanylethylamino]methylidene]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CCNC(=O)C1CC1)NCCSc1ccccc1F |
| InChI | InChI=1S/C17H25FN4OS/c1-2-19-17(21-10-9-20-16(23)13-7-8-13)22-11-12-24-15-6-4-3-5-14(15)18/h3-6,13H,2,7-12H2,1H3,(H,20,23)(H2,19,21,22) |
| InChIKey | XWKBVUBOTCIOLV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|