C14H21BrN4O — CID 111095074
N-[2-[[amino-(tert-butylamino)methylidene]amino]ethyl]-3-bromobenzamide (PubChem CID 111095074) has the molecular formula C14H21BrN4O and a molecular weight of 341.25 g/mol. Its IUPAC name is N-[2-[[amino-(tert-butylamino)methylidene]amino]ethyl]-3-bromobenzamide.
| Compound Name | N-[2-[[amino-(tert-butylamino)methylidene]amino]ethyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 111095074 |
| Molecular Formula | C14H21BrN4O |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-[2-[[amino-(tert-butylamino)methylidene]amino]ethyl]-3-bromobenzamide |
| SMILES | CC(C)(C)N/C(N)=N/CCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H21BrN4O/c1-14(2,3)19-13(16)18-8-7-17-12(20)10-5-4-6-11(15)9-10/h4-6,9H,7-8H2,1-3H3,(H,17,20)(H3,16,18,19) |
| InChIKey | WZZQKUQJPDOCFY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|