C17H18BrClN4O2 — CID 111095118
N-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]-3-bromobenzamide (PubChem CID 111095118) has the molecular formula C17H18BrClN4O2 and a molecular weight of 425.71 g/mol. Its IUPAC name is N-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]-3-bromobenzamide.
| Compound Name | N-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 111095118 |
| Molecular Formula | C17H18BrClN4O2 |
| Molecular Weight | 425.71 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | N-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]-3-bromobenzamide |
| SMILES | COc1ccc(N/C(N)=N/CCNC(=O)c2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C17H18BrClN4O2/c1-25-15-6-5-13(10-14(15)19)23-17(20)22-8-7-21-16(24)11-3-2-4-12(18)9-11/h2-6,9-10H,7-8H2,1H3,(H,21,24)(H3,20,22,23) |
| InChIKey | JIUMGVBOGFSAHV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|