C19H23ClN4O2 — CID 111819592
3-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111819592) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 3-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111819592 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | COc1ccc(N/C(N)=N/CCc2cccc(C(=O)N(C)C)c2)cc1Cl |
| InChI | InChI=1S/C19H23ClN4O2/c1-24(2)18(25)14-6-4-5-13(11-14)9-10-22-19(21)23-15-7-8-17(26-3)16(20)12-15/h4-8,11-12H,9-10H2,1-3H3,(H3,21,22,23) |
| InChIKey | YLFBPJPBBNCOSH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|