C19H21F3N4O2 — CID 111819584
3-[2-[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111819584) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is 3-[2-[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111819584 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-[2-[[amino-[4-(trifluoromethoxy)anilino]methylidene]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(CC/N=C(\N)Nc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H21F3N4O2/c1-26(2)17(27)14-5-3-4-13(12-14)10-11-24-18(23)25-15-6-8-16(9-7-15)28-19(20,21)22/h3-9,12H,10-11H2,1-2H3,(H3,23,24,25) |
| InChIKey | VDFDYWNQNVTQKY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|