C20H27ClIN3O3S — CID 111806611
2-[2-(4-tert-butylphenyl)sulfonylethyl]-1-(3-chloro-4-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111806611) has the molecular formula C20H27ClIN3O3S and a molecular weight of 551.88 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)sulfonylethyl]-1-(3-chloro-4-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-tert-butylphenyl)sulfonylethyl]-1-(3-chloro-4-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111806611 |
| Molecular Formula | C20H27ClIN3O3S |
| Molecular Weight | 551.88 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)sulfonylethyl]-1-(3-chloro-4-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1Cl.I |
| InChI | InChI=1S/C20H26ClN3O3S.HI/c1-20(2,3)14-5-8-16(9-6-14)28(25,26)12-11-23-19(22)24-15-7-10-18(27-4)17(21)13-15;/h5-10,13H,11-12H2,1-4H3,(H3,22,23,24);1H |
| InChIKey | MZRKHHCOKCGSBC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|