C8H19N3O2S — CID 62362821
1-tert-butyl-2-(2-methylsulfonylethyl)guanidine (PubChem CID 62362821) has the molecular formula C8H19N3O2S and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-tert-butyl-2-(2-methylsulfonylethyl)guanidine.
| Compound Name | 1-tert-butyl-2-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 62362821 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-tert-butyl-2-(2-methylsulfonylethyl)guanidine |
| SMILES | CC(C)(C)N/C(N)=N/CCS(C)(=O)=O |
| InChI | InChI=1S/C8H19N3O2S/c1-8(2,3)11-7(9)10-5-6-14(4,12)13/h5-6H2,1-4H3,(H3,9,10,11) |
| InChIKey | QOAQAYKGDGGGKF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|