About 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine
2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine (PubChem CID 119164667) has the molecular formula C11H16FN3O2S
and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine |
| PubChem CID | 119164667 |
| Molecular Formula | C11H16FN3O2S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/CCS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H16FN3O2S/c1-15(2)11(13)14-7-8-18(16,17)10-5-3-9(12)4-6-10/h3-6H,7-8H2,1-2H3,(H2,13,14) |
| InChIKey | ZXJRHNRQFMFCEJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine?
The IUPAC name of 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine (CID 119164667) is 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine.
What is the SMILES notation for 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine?
The canonical SMILES for 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine is CN(C)/C(N)=N/CCS(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine?
The InChIKey is ZXJRHNRQFMFCEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FN3O2S/c1-15(2)11(13)14-7-8-18(16,17)10-5-3-9(12)4-6-10/h3-6H,7-8H2,1-2H3,(H2,13,14).
What are the key properties of 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine?
2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine has a molecular weight of 273.33 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-fluorophenyl)sulfonylethyl]-1,1-dimethylguanidine is sourced from PubChem (CID 119164667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).