C12H18FN5 — CID 118466379
2-[N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]-1,1-dimethylguanidine (PubChem CID 118466379) has the molecular formula C12H18FN5 and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-[N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]-1,1-dimethylguanidine.
| Compound Name | 2-[N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 118466379 |
| Molecular Formula | C12H18FN5 |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[N'-[2-(4-fluorophenyl)ethyl]carbamimidoyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/C(N)=N/CCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H18FN5/c1-18(2)12(15)17-11(14)16-8-7-9-3-5-10(13)6-4-9/h3-6H,7-8H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | GRIQVXOIEGBDOS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|