C14H19FN6 — CID 159763293
2-[N'-[2-(2-fluoro-7H-cyclopenta[b]pyridin-5-yl)ethyl]carbamimidoyl]-1,1-dimethylguanidine (PubChem CID 159763293) has the molecular formula C14H19FN6 and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-[N'-[2-(2-fluoro-7H-cyclopenta[b]pyridin-5-yl)ethyl]carbamimidoyl]-1,1-dimethylguanidine.
| Compound Name | 2-[N'-[2-(2-fluoro-7H-cyclopenta[b]pyridin-5-yl)ethyl]carbamimidoyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 159763293 |
| Molecular Formula | C14H19FN6 |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[N'-[2-(2-fluoro-7H-cyclopenta[b]pyridin-5-yl)ethyl]carbamimidoyl]-1,1-dimethylguanidine |
| SMILES | CN(C)C(N)=N/C(N)=N/CCC1=CCc2nc(F)ccc21 |
| InChI | InChI=1S/C14H19FN6/c1-21(2)14(17)20-13(16)18-8-7-9-3-5-11-10(9)4-6-12(15)19-11/h3-4,6H,5,7-8H2,1-2H3,(H4,16,17,18,20) |
| InChIKey | NFEFMRAIFOYLLT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|