C9H16ClN5O — CID 53307570
2-[N'-(furan-2-ylmethyl)carbamimidoyl]-1,1-dimethylguanidine;hydrochloride (PubChem CID 53307570) has the molecular formula C9H16ClN5O and a molecular weight of 245.71 g/mol. Its IUPAC name is 2-[N'-(furan-2-ylmethyl)carbamimidoyl]-1,1-dimethylguanidine;hydrochloride.
| Compound Name | 2-[N'-(furan-2-ylmethyl)carbamimidoyl]-1,1-dimethylguanidine;hydrochloride |
|---|---|
| PubChem CID | 53307570 |
| Molecular Formula | C9H16ClN5O |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-[N'-(furan-2-ylmethyl)carbamimidoyl]-1,1-dimethylguanidine;hydrochloride |
| SMILES | CN(C)/C(N)=N/C(N)=N/Cc1ccco1.Cl |
| InChI | InChI=1S/C9H15N5O.ClH/c1-14(2)9(11)13-8(10)12-6-7-4-3-5-15-7;/h3-5H,6H2,1-2H3,(H4,10,11,12,13);1H |
| InChIKey | RSPQYSWTNIXHQV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|