C10H18N6 — CID 123690358
1,1-dimethyl-2-[N'-[(4-methyl-1H-pyrrol-3-yl)methyl]carbamimidoyl]guanidine (PubChem CID 123690358) has the molecular formula C10H18N6 and a molecular weight of 222.30 g/mol. Its IUPAC name is 1,1-dimethyl-2-[N'-[(4-methyl-1H-pyrrol-3-yl)methyl]carbamimidoyl]guanidine.
| Compound Name | 1,1-dimethyl-2-[N'-[(4-methyl-1H-pyrrol-3-yl)methyl]carbamimidoyl]guanidine |
|---|---|
| PubChem CID | 123690358 |
| Molecular Formula | C10H18N6 |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1,1-dimethyl-2-[N'-[(4-methyl-1H-pyrrol-3-yl)methyl]carbamimidoyl]guanidine |
| SMILES | Cc1c[nH]cc1C/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C10H18N6/c1-7-4-13-5-8(7)6-14-9(11)15-10(12)16(2)3/h4-5,13H,6H2,1-3H3,(H4,11,12,14,15) |
| InChIKey | VAKMBWHRHYHTSE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|