C8H17N5 — CID 140599397
2-[N'-(cyclopropylmethyl)carbamimidoyl]-1,1-dimethylguanidine (PubChem CID 140599397) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is 2-[N'-(cyclopropylmethyl)carbamimidoyl]-1,1-dimethylguanidine.
| Compound Name | 2-[N'-(cyclopropylmethyl)carbamimidoyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 140599397 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | 2-[N'-(cyclopropylmethyl)carbamimidoyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N\C(N)=N\CC1CC1 |
| InChI | InChI=1S/C8H17N5/c1-13(2)8(10)12-7(9)11-5-6-3-4-6/h6H,3-5H2,1-2H3,(H4,9,10,11,12) |
| InChIKey | RTJJZFMEARRGGY-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|