C14H30IN3 — CID 111076575
2-[(4-ethylcyclohexyl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111076575) has the molecular formula C14H30IN3 and a molecular weight of 367.32 g/mol. Its IUPAC name is 2-[(4-ethylcyclohexyl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[(4-ethylcyclohexyl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111076575 |
| Molecular Formula | C14H30IN3 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[(4-ethylcyclohexyl)methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CCC1CCC(CN=C(N(C)C)N(C)C)CC1.I |
| InChI | InChI=1S/C14H29N3.HI/c1-6-12-7-9-13(10-8-12)11-15-14(16(2)3)17(4)5;/h12-13H,6-11H2,1-5H3;1H |
| InChIKey | NGVLEVGAIFRZFU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|