C11H23N5 — CID 83032402
1-(diaminomethylidene)-2-[(4-ethylcyclohexyl)methyl]guanidine (PubChem CID 83032402) has the molecular formula C11H23N5 and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[(4-ethylcyclohexyl)methyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[(4-ethylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 83032402 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | 1-(diaminomethylidene)-2-[(4-ethylcyclohexyl)methyl]guanidine |
| SMILES | CCC1CCC(C/N=C(\N)N=C(N)N)CC1 |
| InChI | InChI=1S/C11H23N5/c1-2-8-3-5-9(6-4-8)7-15-11(14)16-10(12)13/h8-9H,2-7H2,1H3,(H6,12,13,14,15,16) |
| InChIKey | FEDFVPREICWCSH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|