C15H29N3 — CID 122096529
2-[[(1R,2S)-2-cyclohexylcyclopropyl]methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 122096529) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-cyclohexylcyclopropyl]methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[[(1R,2S)-2-cyclohexylcyclopropyl]methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 122096529 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 2-[[(1R,2S)-2-cyclohexylcyclopropyl]methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NC[C@@H]1C[C@H]1C1CCCCC1)N(C)C |
| InChI | InChI=1S/C15H29N3/c1-17(2)15(18(3)4)16-11-13-10-14(13)12-8-6-5-7-9-12/h12-14H,5-11H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | JRVZLCPFQBMXBZ-KBPBESRZSA-N |
| XLogP | 2.68 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|