C12H16FN5 — CID 21492995
(1Z)-1-[amino-(4-fluoroanilino)methylidene]-2-(cyclopropylmethyl)guanidine (PubChem CID 21492995) has the molecular formula C12H16FN5 and a molecular weight of 249.29 g/mol. Its IUPAC name is (1Z)-1-[amino-(4-fluoroanilino)methylidene]-2-(cyclopropylmethyl)guanidine.
| Compound Name | (1Z)-1-[amino-(4-fluoroanilino)methylidene]-2-(cyclopropylmethyl)guanidine |
|---|---|
| PubChem CID | 21492995 |
| Molecular Formula | C12H16FN5 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (1Z)-1-[amino-(4-fluoroanilino)methylidene]-2-(cyclopropylmethyl)guanidine |
| SMILES | N/C(=N/C(N)=N/CC1CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FN5/c13-9-3-5-10(6-4-9)17-12(15)18-11(14)16-7-8-1-2-8/h3-6,8H,1-2,7H2,(H5,14,15,16,17,18) |
| InChIKey | SQDMETYQNIKUBD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|