C11H17N5 — CID 45097615
(1E)-1-[amino-(4-methylanilino)methylidene]-2-ethylguanidine (PubChem CID 45097615) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is (1E)-1-[amino-(4-methylanilino)methylidene]-2-ethylguanidine.
| Compound Name | (1E)-1-[amino-(4-methylanilino)methylidene]-2-ethylguanidine |
|---|---|
| PubChem CID | 45097615 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (1E)-1-[amino-(4-methylanilino)methylidene]-2-ethylguanidine |
| SMILES | CC/N=C(N)/N=C(\N)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C11H17N5/c1-3-14-10(12)16-11(13)15-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3,(H5,12,13,14,15,16) |
| InChIKey | HKNZEGSMGHLSRL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|