C10H17ClN6 — CID 140599394
1,1-dimethyl-2-[N'-(pyridin-3-ylmethyl)carbamimidoyl]guanidine;hydrochloride (PubChem CID 140599394) has the molecular formula C10H17ClN6 and a molecular weight of 256.74 g/mol. Its IUPAC name is 1,1-dimethyl-2-[N'-(pyridin-3-ylmethyl)carbamimidoyl]guanidine;hydrochloride.
| Compound Name | 1,1-dimethyl-2-[N'-(pyridin-3-ylmethyl)carbamimidoyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 140599394 |
| Molecular Formula | C10H17ClN6 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1,1-dimethyl-2-[N'-(pyridin-3-ylmethyl)carbamimidoyl]guanidine;hydrochloride |
| SMILES | CN(C)/C(N)=N\C(N)=N\Cc1cccnc1.Cl |
| InChI | InChI=1S/C10H16N6.ClH/c1-16(2)10(12)15-9(11)14-7-8-4-3-5-13-6-8;/h3-6H,7H2,1-2H3,(H4,11,12,14,15);1H |
| InChIKey | VUPMXOKLLYUEAM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|