C16H26N6O2 — CID 66687048
[4-[[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]methyl]phenyl] N,N-diethylcarbamate (PubChem CID 66687048) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is [4-[[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]methyl]phenyl] N,N-diethylcarbamate.
| Compound Name | [4-[[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]methyl]phenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 66687048 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [4-[[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]methyl]phenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc(C/N=C(\N)N=C(N)N(C)C)cc1 |
| InChI | InChI=1S/C16H26N6O2/c1-5-22(6-2)16(23)24-13-9-7-12(8-10-13)11-19-14(17)20-15(18)21(3)4/h7-10H,5-6,11H2,1-4H3,(H4,17,18,19,20) |
| InChIKey | NLPCEHFLAFJBMW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|