C19H34ClN5 — CID 86657144
1-methyl-2-[N'-[(4-methylphenyl)methyl]carbamimidoyl]-1-octylguanidine;hydrochloride (PubChem CID 86657144) has the molecular formula C19H34ClN5 and a molecular weight of 367.97 g/mol. Its IUPAC name is 1-methyl-2-[N'-[(4-methylphenyl)methyl]carbamimidoyl]-1-octylguanidine;hydrochloride.
| Compound Name | 1-methyl-2-[N'-[(4-methylphenyl)methyl]carbamimidoyl]-1-octylguanidine;hydrochloride |
|---|---|
| PubChem CID | 86657144 |
| Molecular Formula | C19H34ClN5 |
| Molecular Weight | 367.97 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 1-methyl-2-[N'-[(4-methylphenyl)methyl]carbamimidoyl]-1-octylguanidine;hydrochloride |
| SMILES | CCCCCCCCN(C)C(N)=N/C(N)=N/Cc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C19H33N5.ClH/c1-4-5-6-7-8-9-14-24(3)19(21)23-18(20)22-15-17-12-10-16(2)11-13-17;/h10-13H,4-9,14-15H2,1-3H3,(H4,20,21,22,23);1H |
| InChIKey | IZRNNBOACJIVDJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|