About 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride
2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride (PubChem CID 86657128) has the molecular formula C18H32Cl3N5
and a molecular weight of 424.85 g/mol. Its IUPAC name is 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride.
Molecular Properties
| Compound Name | 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride |
| PubChem CID | 86657128 |
| Molecular Formula | C18H32Cl3N5 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride |
| SMILES | CCCCCCCCN(C)C(N)=N/C(N)=N/Cc1ccc(Cl)cc1.Cl.Cl |
| InChI | InChI=1S/C18H30ClN5.2ClH/c1-3-4-5-6-7-8-13-24(2)18(21)23-17(20)22-14-15-9-11-16(19)12-10-15;;/h9-12H,3-8,13-14H2,1-2H3,(H4,20,21,22,23);2*1H |
| InChIKey | RDDSTILJRNJZNP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride?
The IUPAC name of 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride (CID 86657128) is 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride.
What is the SMILES notation for 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride?
The canonical SMILES for 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride is CCCCCCCCN(C)C(N)=N/C(N)=N/Cc1ccc(Cl)cc1.Cl.Cl.
What is the InChIKey of 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride?
The InChIKey is RDDSTILJRNJZNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30ClN5.2ClH/c1-3-4-5-6-7-8-13-24(2)18(21)23-17(20)22-14-15-9-11-16(19)12-10-15;;/h9-12H,3-8,13-14H2,1-2H3,(H4,20,21,22,23);2*1H.
What are the key properties of 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride?
2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride has a molecular weight of 424.85 g/mol, XLogP of 4.61, 9 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride is sourced from PubChem (CID 86657128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).