C18H32Cl3N5 — CID 86657128
2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride (PubChem CID 86657128) has the molecular formula C18H32Cl3N5 and a molecular weight of 424.85 g/mol. Its IUPAC name is 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride.
| Compound Name | 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride |
|---|---|
| PubChem CID | 86657128 |
| Molecular Formula | C18H32Cl3N5 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-1-methyl-1-octylguanidine;dihydrochloride |
| SMILES | CCCCCCCCN(C)C(N)=N/C(N)=N/Cc1ccc(Cl)cc1.Cl.Cl |
| InChI | InChI=1S/C18H30ClN5.2ClH/c1-3-4-5-6-7-8-13-24(2)18(21)23-17(20)22-14-15-9-11-16(19)12-10-15;;/h9-12H,3-8,13-14H2,1-2H3,(H4,20,21,22,23);2*1H |
| InChIKey | RDDSTILJRNJZNP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|