C10H15Cl2N5 — CID 24839279
1-carbamimidoyl-2-[(4-chlorophenyl)methyl]-1-methylguanidine;hydrochloride (PubChem CID 24839279) has the molecular formula C10H15Cl2N5 and a molecular weight of 276.17 g/mol. Its IUPAC name is 1-carbamimidoyl-2-[(4-chlorophenyl)methyl]-1-methylguanidine;hydrochloride.
| Compound Name | 1-carbamimidoyl-2-[(4-chlorophenyl)methyl]-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 24839279 |
| Molecular Formula | C10H15Cl2N5 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-carbamimidoyl-2-[(4-chlorophenyl)methyl]-1-methylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N(C)/C(N)=N/Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H14ClN5.ClH/c1-16(9(12)13)10(14)15-6-7-2-4-8(11)5-3-7;/h2-5H,6H2,1H3,(H3,12,13)(H2,14,15);1H |
| InChIKey | CSVFGSSIZYOOFH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|