C9H12ClN5 — CID 24839284
1-carbamimidoyl-1-[(4-chlorophenyl)methyl]guanidine (PubChem CID 24839284) has the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. Its IUPAC name is 1-carbamimidoyl-1-[(4-chlorophenyl)methyl]guanidine.
| Compound Name | 1-carbamimidoyl-1-[(4-chlorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 24839284 |
| Molecular Formula | C9H12ClN5 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-carbamimidoyl-1-[(4-chlorophenyl)methyl]guanidine |
| SMILES | [H]/N=C(\N)N(Cc1ccc(Cl)cc1)/C(N)=N/[H] |
| InChI | InChI=1S/C9H12ClN5/c10-7-3-1-6(2-4-7)5-15(8(11)12)9(13)14/h1-4H,5H2,(H3,11,12)(H3,13,14) |
| InChIKey | JXEBULAFFOLMJW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|