C9H13ClN6O3 — CID 24839283
1-carbamimidoyl-1-[(4-chlorophenyl)methyl]guanidine;nitric acid (PubChem CID 24839283) has the molecular formula C9H13ClN6O3 and a molecular weight of 288.70 g/mol. Its IUPAC name is 1-carbamimidoyl-1-[(4-chlorophenyl)methyl]guanidine;nitric acid.
| Compound Name | 1-carbamimidoyl-1-[(4-chlorophenyl)methyl]guanidine;nitric acid |
|---|---|
| PubChem CID | 24839283 |
| Molecular Formula | C9H13ClN6O3 |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-carbamimidoyl-1-[(4-chlorophenyl)methyl]guanidine;nitric acid |
| SMILES | O=[N+]([O-])O.[H]/N=C(\N)N(Cc1ccc(Cl)cc1)/C(N)=N/[H] |
| InChI | InChI=1S/C9H12ClN5.HNO3/c10-7-3-1-6(2-4-7)5-15(8(11)12)9(13)14;2-1(3)4/h1-4H,5H2,(H3,11,12)(H3,13,14);(H,2,3,4) |
| InChIKey | UDJDFIYIUXRKRS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|