C24H32Cl2N4 — CID 142934352
1-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-1-methylguanidine (PubChem CID 142934352) has the molecular formula C24H32Cl2N4 and a molecular weight of 447.45 g/mol. Its IUPAC name is 1-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-1-methylguanidine.
| Compound Name | 1-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 142934352 |
| Molecular Formula | C24H32Cl2N4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)CC1CCC(CN(Cc2ccc(Cl)cc2)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H32Cl2N4/c1-29(24(27)28)14-18-2-4-19(5-3-18)15-30(16-20-6-10-22(25)11-7-20)17-21-8-12-23(26)13-9-21/h6-13,18-19H,2-5,14-17H2,1H3,(H3,27,28) |
| InChIKey | HREUHHYYBJNIPQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|