C25H31Cl2N5 — CID 142934636
1-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-3-cyano-2-methylguanidine (PubChem CID 142934636) has the molecular formula C25H31Cl2N5 and a molecular weight of 472.46 g/mol. Its IUPAC name is 1-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-3-cyano-2-methylguanidine.
| Compound Name | 1-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-3-cyano-2-methylguanidine |
|---|---|
| PubChem CID | 142934636 |
| Molecular Formula | C25H31Cl2N5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-3-cyano-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCC1CCC(CN(Cc2ccc(Cl)cc2)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H31Cl2N5/c1-29-25(31-18-28)30-14-19-2-4-20(5-3-19)15-32(16-21-6-10-23(26)11-7-21)17-22-8-12-24(27)13-9-22/h6-13,19-20H,2-5,14-17H2,1H3,(H2,29,30,31) |
| InChIKey | PJHZNXBDLSDXAE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|