C30H32Cl2N4O — CID 142934505
phenyl N'-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-N-cyanocarbamimidate (PubChem CID 142934505) has the molecular formula C30H32Cl2N4O and a molecular weight of 535.52 g/mol. Its IUPAC name is phenyl N'-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-N-cyanocarbamimidate.
| Compound Name | phenyl N'-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-N-cyanocarbamimidate |
|---|---|
| PubChem CID | 142934505 |
| Molecular Formula | C30H32Cl2N4O |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | phenyl N'-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]-N-cyanocarbamimidate |
| SMILES | N#CN/C(=N\CC1CCC(CN(Cc2ccc(Cl)cc2)Cc2ccc(Cl)cc2)CC1)Oc1ccccc1 |
| InChI | InChI=1S/C30H32Cl2N4O/c31-27-14-10-25(11-15-27)20-36(21-26-12-16-28(32)17-13-26)19-24-8-6-23(7-9-24)18-34-30(35-22-33)37-29-4-2-1-3-5-29/h1-5,10-17,23-24H,6-9,18-21H2,(H,34,35) |
| InChIKey | LTSRWKVXQBWLNP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 60.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|