C23H30Cl2N4 — CID 10432992
2-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]guanidine (PubChem CID 10432992) has the molecular formula C23H30Cl2N4 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]guanidine.
| Compound Name | 2-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 10432992 |
| Molecular Formula | C23H30Cl2N4 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-[[4-[[bis[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]methyl]guanidine |
| SMILES | NC(N)=NCC1CCC(CN(Cc2ccc(Cl)cc2)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H30Cl2N4/c24-21-9-5-19(6-10-21)15-29(16-20-7-11-22(25)12-8-20)14-18-3-1-17(2-4-18)13-28-23(26)27/h5-12,17-18H,1-4,13-16H2,(H4,26,27,28) |
| InChIKey | WVCMNVZZNDRGIN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|