C23H28ClN5S — CID 142934434
2-[3-[[1,3-benzothiazol-2-ylmethyl-[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]guanidine (PubChem CID 142934434) has the molecular formula C23H28ClN5S and a molecular weight of 442.03 g/mol. Its IUPAC name is 2-[3-[[1,3-benzothiazol-2-ylmethyl-[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]guanidine.
| Compound Name | 2-[3-[[1,3-benzothiazol-2-ylmethyl-[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]guanidine |
|---|---|
| PubChem CID | 142934434 |
| Molecular Formula | C23H28ClN5S |
| Molecular Weight | 442.03 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[3-[[1,3-benzothiazol-2-ylmethyl-[(4-chlorophenyl)methyl]amino]methyl]cyclohexyl]guanidine |
| SMILES | NC(N)=NC1CCCC(CN(Cc2ccc(Cl)cc2)Cc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C23H28ClN5S/c24-18-10-8-16(9-11-18)13-29(14-17-4-3-5-19(12-17)27-23(25)26)15-22-28-20-6-1-2-7-21(20)30-22/h1-2,6-11,17,19H,3-5,12-15H2,(H4,25,26,27) |
| InChIKey | ZYBIGZYWTMVKAN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.03 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|