C15H18ClNS — CID 79819037
2-[(3-chlorocycloheptyl)methyl]-1,3-benzothiazole (PubChem CID 79819037) has the molecular formula C15H18ClNS and a molecular weight of 279.84 g/mol. Its IUPAC name is 2-[(3-chlorocycloheptyl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(3-chlorocycloheptyl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 79819037 |
| Molecular Formula | C15H18ClNS |
| Molecular Weight | 279.84 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[(3-chlorocycloheptyl)methyl]-1,3-benzothiazole |
| SMILES | ClC1CCCCC(Cc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C15H18ClNS/c16-12-6-2-1-5-11(9-12)10-15-17-13-7-3-4-8-14(13)18-15/h3-4,7-8,11-12H,1-2,5-6,9-10H2 |
| InChIKey | FWYTZSKSXWCINU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.84 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|