C15H19ClN2S — CID 104632079
N-(1,3-benzothiazol-2-ylmethyl)-2-chlorocycloheptan-1-amine (PubChem CID 104632079) has the molecular formula C15H19ClN2S and a molecular weight of 294.85 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-chlorocycloheptan-1-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-chlorocycloheptan-1-amine |
|---|---|
| PubChem CID | 104632079 |
| Molecular Formula | C15H19ClN2S |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-chlorocycloheptan-1-amine |
| SMILES | ClC1CCCCCC1NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H19ClN2S/c16-11-6-2-1-3-7-12(11)17-10-15-18-13-8-4-5-9-14(13)19-15/h4-5,8-9,11-12,17H,1-3,6-7,10H2 |
| InChIKey | SPMTZIWOQMKGRE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|