3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid

C14H16N2O2S — CID 67401826

IUPAC3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid
SMILESO=C(O)N1CCCC(Cc2nc3ccccc3s2)C1
InChIInChI=1S/C14H16N2O2S/c17-14(18)16-7-3-4-10(9-16)8-13-15-11-5-1-2-6-12(11)19-13/h1-2,5-6,10H,3-4,7-9H2,(H,17,18)
InChIKeyZROWXIGJJXAAFQ-UHFFFAOYSA-N
MW276.36 g/mol
LogP3.23
Rot. Bonds2

About 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid

3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid (PubChem CID 67401826) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid.

Molecular Properties

Compound Name3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid
PubChem CID67401826
Molecular FormulaC14H16N2O2S
Molecular Weight276.36 g/mol
Exact Mass276.09
IUPAC Name3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid
SMILESO=C(O)N1CCCC(Cc2nc3ccccc3s2)C1
InChIInChI=1S/C14H16N2O2S/c17-14(18)16-7-3-4-10(9-16)8-13-15-11-5-1-2-6-12(11)19-13/h1-2,5-6,10H,3-4,7-9H2,(H,17,18)
InChIKeyZROWXIGJJXAAFQ-UHFFFAOYSA-N
XLogP3.23
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.36
LogP ≤ 53.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid?
The IUPAC name of 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid (CID 67401826) is 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid.
What is the SMILES notation for 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid?
The canonical SMILES for 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid is O=C(O)N1CCCC(Cc2nc3ccccc3s2)C1.
What is the InChIKey of 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid?
The InChIKey is ZROWXIGJJXAAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S/c17-14(18)16-7-3-4-10(9-16)8-13-15-11-5-1-2-6-12(11)19-13/h1-2,5-6,10H,3-4,7-9H2,(H,17,18).
What are the key properties of 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid?
3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid has a molecular weight of 276.36 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-ylmethyl)piperidine-1-carboxylic acid is sourced from PubChem (CID 67401826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).