C17H20N2OS — CID 144766374
1,3-benzothiazol-2-yl-[(3S)-3-[(E)-but-2-enyl]piperidin-1-yl]methanone (PubChem CID 144766374) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl-[(3S)-3-[(E)-but-2-enyl]piperidin-1-yl]methanone.
| Compound Name | 1,3-benzothiazol-2-yl-[(3S)-3-[(E)-but-2-enyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 144766374 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1,3-benzothiazol-2-yl-[(3S)-3-[(E)-but-2-enyl]piperidin-1-yl]methanone |
| SMILES | C/C=C/C[C@@H]1CCCN(C(=O)c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C17H20N2OS/c1-2-3-7-13-8-6-11-19(12-13)17(20)16-18-14-9-4-5-10-15(14)21-16/h2-5,9-10,13H,6-8,11-12H2,1H3/b3-2+/t13-/m1/s1 |
| InChIKey | QCNXQSMTPJCYER-YWVDXFKGSA-N |
| XLogP | 4.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|