C18H21NS — CID 158581770
2-(2-adamantylmethyl)-1,3-benzothiazole (PubChem CID 158581770) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-(2-adamantylmethyl)-1,3-benzothiazole.
| Compound Name | 2-(2-adamantylmethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 158581770 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(2-adamantylmethyl)-1,3-benzothiazole |
| SMILES | c1ccc2sc(CC3C4CC5CC(C4)CC3C5)nc2c1 |
| InChI | InChI=1S/C18H21NS/c1-2-4-17-16(3-1)19-18(20-17)10-15-13-6-11-5-12(8-13)9-14(15)7-11/h1-4,11-15H,5-10H2 |
| InChIKey | GFDAUDPEXWAFHR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |