C13H14BrNOS — CID 106471595
2-[(4-bromooxan-3-yl)methyl]-1,3-benzothiazole (PubChem CID 106471595) has the molecular formula C13H14BrNOS and a molecular weight of 312.23 g/mol. Its IUPAC name is 2-[(4-bromooxan-3-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(4-bromooxan-3-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 106471595 |
| Molecular Formula | C13H14BrNOS |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-[(4-bromooxan-3-yl)methyl]-1,3-benzothiazole |
| SMILES | BrC1CCOCC1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H14BrNOS/c14-10-5-6-16-8-9(10)7-13-15-11-3-1-2-4-12(11)17-13/h1-4,9-10H,5-8H2 |
| InChIKey | KQJRAYUMMPDMBN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|