C13H16N2OS2 — CID 104755154
2-(1,3-benzothiazol-2-ylsulfanyl)-1-(oxolan-3-yl)ethanamine (PubChem CID 104755154) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-1-(oxolan-3-yl)ethanamine.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 104755154 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1-(oxolan-3-yl)ethanamine |
| SMILES | NC(CSc1nc2ccccc2s1)C1CCOC1 |
| InChI | InChI=1S/C13H16N2OS2/c14-10(9-5-6-16-7-9)8-17-13-15-11-3-1-2-4-12(11)18-13/h1-4,9-10H,5-8,14H2 |
| InChIKey | AZXZVGPSEOOLAR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |