C14H17NOS — CID 79818705
3-(1,3-benzothiazol-2-ylmethyl)-2-methylcyclopentan-1-ol (PubChem CID 79818705) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethyl)-2-methylcyclopentan-1-ol.
| Compound Name | 3-(1,3-benzothiazol-2-ylmethyl)-2-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 79818705 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylmethyl)-2-methylcyclopentan-1-ol |
| SMILES | CC1C(O)CCC1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H17NOS/c1-9-10(6-7-12(9)16)8-14-15-11-4-2-3-5-13(11)17-14/h2-5,9-10,12,16H,6-8H2,1H3 |
| InChIKey | AILSMUGCMJQGFJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |