C16H18ClNS — CID 66461747
2-[2-(2-bicyclo[2.2.1]heptanyl)-2-chloroethyl]-1,3-benzothiazole (PubChem CID 66461747) has the molecular formula C16H18ClNS and a molecular weight of 291.85 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]heptanyl)-2-chloroethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]heptanyl)-2-chloroethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 66461747 |
| Molecular Formula | C16H18ClNS |
| Molecular Weight | 291.85 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]heptanyl)-2-chloroethyl]-1,3-benzothiazole |
| SMILES | ClC(Cc1nc2ccccc2s1)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H18ClNS/c17-13(12-8-10-5-6-11(12)7-10)9-16-18-14-3-1-2-4-15(14)19-16/h1-4,10-13H,5-9H2 |
| InChIKey | SVRAEPNIGIWNKY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|