C16H20ClNOS — CID 66461547
2-[2-chloro-2-(2,4,5-trimethyloxolan-3-yl)ethyl]-1,3-benzothiazole (PubChem CID 66461547) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is 2-[2-chloro-2-(2,4,5-trimethyloxolan-3-yl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-chloro-2-(2,4,5-trimethyloxolan-3-yl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 66461547 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-[2-chloro-2-(2,4,5-trimethyloxolan-3-yl)ethyl]-1,3-benzothiazole |
| SMILES | CC1OC(C)C(C(Cl)Cc2nc3ccccc3s2)C1C |
| InChI | InChI=1S/C16H20ClNOS/c1-9-10(2)19-11(3)16(9)12(17)8-15-18-13-6-4-5-7-14(13)20-15/h4-7,9-12,16H,8H2,1-3H3 |
| InChIKey | BSTXTDVXUQOFEW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|