C14H18ClNS — CID 66459330
2-(2-chloroheptyl)-1,3-benzothiazole (PubChem CID 66459330) has the molecular formula C14H18ClNS and a molecular weight of 267.82 g/mol. Its IUPAC name is 2-(2-chloroheptyl)-1,3-benzothiazole.
| Compound Name | 2-(2-chloroheptyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 66459330 |
| Molecular Formula | C14H18ClNS |
| Molecular Weight | 267.82 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-(2-chloroheptyl)-1,3-benzothiazole |
| SMILES | CCCCCC(Cl)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H18ClNS/c1-2-3-4-7-11(15)10-14-16-12-8-5-6-9-13(12)17-14/h5-6,8-9,11H,2-4,7,10H2,1H3 |
| InChIKey | JYADQZZTKHGHBT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.82 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|