C18H21N3S — CID 57032536
2-[2-(pyrimidin-2-ylmethyl)hexyl]-1,3-benzothiazole (PubChem CID 57032536) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-[2-(pyrimidin-2-ylmethyl)hexyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(pyrimidin-2-ylmethyl)hexyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 57032536 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-[2-(pyrimidin-2-ylmethyl)hexyl]-1,3-benzothiazole |
| SMILES | CCCCC(Cc1ncccn1)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H21N3S/c1-2-3-7-14(12-17-19-10-6-11-20-17)13-18-21-15-8-4-5-9-16(15)22-18/h4-6,8-11,14H,2-3,7,12-13H2,1H3 |
| InChIKey | FPQMTORLBALZKK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |