C20H24N2OS — CID 46532413
N-(1,3-benzothiazol-2-ylmethyl)-N-methyladamantane-2-carboxamide (PubChem CID 46532413) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-N-methyladamantane-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methyladamantane-2-carboxamide |
|---|---|
| PubChem CID | 46532413 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methyladamantane-2-carboxamide |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H24N2OS/c1-22(11-18-21-16-4-2-3-5-17(16)24-18)20(23)19-14-7-12-6-13(9-14)10-15(19)8-12/h2-5,12-15,19H,6-11H2,1H3 |
| InChIKey | VVYJERSIRGGXAK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |