C21H28ClN3 — CID 23795070
[4-[[(4-chlorophenyl)methyl-(pyridin-4-ylmethyl)amino]methyl]cyclohexyl]methanamine (PubChem CID 23795070) has the molecular formula C21H28ClN3 and a molecular weight of 357.93 g/mol. Its IUPAC name is [4-[[(4-chlorophenyl)methyl-(pyridin-4-ylmethyl)amino]methyl]cyclohexyl]methanamine.
| Compound Name | [4-[[(4-chlorophenyl)methyl-(pyridin-4-ylmethyl)amino]methyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 23795070 |
| Molecular Formula | C21H28ClN3 |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | [4-[[(4-chlorophenyl)methyl-(pyridin-4-ylmethyl)amino]methyl]cyclohexyl]methanamine |
| SMILES | NCC1CCC(CN(Cc2ccncc2)Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H28ClN3/c22-21-7-5-19(6-8-21)15-25(16-20-9-11-24-12-10-20)14-18-3-1-17(13-23)2-4-18/h5-12,17-18H,1-4,13-16,23H2 |
| InChIKey | BKLMJWZQLKKJLB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |