C15H31N5 — CID 174660091
2-(N'-cyclohexylcarbamimidoyl)-1-hexyl-1-methylguanidine (PubChem CID 174660091) has the molecular formula C15H31N5 and a molecular weight of 281.45 g/mol. Its IUPAC name is 2-(N'-cyclohexylcarbamimidoyl)-1-hexyl-1-methylguanidine.
| Compound Name | 2-(N'-cyclohexylcarbamimidoyl)-1-hexyl-1-methylguanidine |
|---|---|
| PubChem CID | 174660091 |
| Molecular Formula | C15H31N5 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.26 |
| IUPAC Name | 2-(N'-cyclohexylcarbamimidoyl)-1-hexyl-1-methylguanidine |
| SMILES | CCCCCCN(C)C(N)=N/C(N)=N/C1CCCCC1 |
| InChI | InChI=1S/C15H31N5/c1-3-4-5-9-12-20(2)15(17)19-14(16)18-13-10-7-6-8-11-13/h13H,3-12H2,1-2H3,(H4,16,17,18,19) |
| InChIKey | MXDNLFVDHAINGZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|