C12H19N5S — CID 57123133
1-[amino(dimethylamino)methylidene]-3-(3-pyridin-3-ylpropyl)thiourea (PubChem CID 57123133) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 1-[amino(dimethylamino)methylidene]-3-(3-pyridin-3-ylpropyl)thiourea.
| Compound Name | 1-[amino(dimethylamino)methylidene]-3-(3-pyridin-3-ylpropyl)thiourea |
|---|---|
| PubChem CID | 57123133 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1-[amino(dimethylamino)methylidene]-3-(3-pyridin-3-ylpropyl)thiourea |
| SMILES | CN(C)C(N)=NC(=S)NCCCc1cccnc1 |
| InChI | InChI=1S/C12H19N5S/c1-17(2)11(13)16-12(18)15-8-4-6-10-5-3-7-14-9-10/h3,5,7,9H,4,6,8H2,1-2H3,(H3,13,15,16,18) |
| InChIKey | GVYIVCPGGFVBIC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|