C10H15N3O — CID 110872248
1,1-dimethyl-3-(2-pyridin-3-ylethyl)urea (PubChem CID 110872248) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 1,1-dimethyl-3-(2-pyridin-3-ylethyl)urea.
| Compound Name | 1,1-dimethyl-3-(2-pyridin-3-ylethyl)urea |
|---|---|
| PubChem CID | 110872248 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1,1-dimethyl-3-(2-pyridin-3-ylethyl)urea |
| SMILES | CN(C)C(=O)NCCc1cccnc1 |
| InChI | InChI=1S/C10H15N3O/c1-13(2)10(14)12-7-5-9-4-3-6-11-8-9/h3-4,6,8H,5,7H2,1-2H3,(H,12,14) |
| InChIKey | UXCXELIMUQKDKZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |