C14H18FN5 — CID 157399427
1-(diaminomethylidene)-2-[2-(5-fluoro-2-methyl-3H-inden-1-yl)ethyl]guanidine (PubChem CID 157399427) has the molecular formula C14H18FN5 and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(5-fluoro-2-methyl-3H-inden-1-yl)ethyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(5-fluoro-2-methyl-3H-inden-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 157399427 |
| Molecular Formula | C14H18FN5 |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(5-fluoro-2-methyl-3H-inden-1-yl)ethyl]guanidine |
| SMILES | CC1=C(CC/N=C(\N)N=C(N)N)c2ccc(F)cc2C1 |
| InChI | InChI=1S/C14H18FN5/c1-8-6-9-7-10(15)2-3-12(9)11(8)4-5-19-14(18)20-13(16)17/h2-3,7H,4-6H2,1H3,(H6,16,17,18,19,20) |
| InChIKey | BMYSWKVJKLOLLG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|