C12H12F4N6 — CID 146250137
1-(diaminomethylidene)-2-[2-(4,5,6,7-tetrafluoro-1H-indol-3-yl)ethyl]guanidine (PubChem CID 146250137) has the molecular formula C12H12F4N6 and a molecular weight of 316.26 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(4,5,6,7-tetrafluoro-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(4,5,6,7-tetrafluoro-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 146250137 |
| Molecular Formula | C12H12F4N6 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(4,5,6,7-tetrafluoro-1H-indol-3-yl)ethyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/CCc1c[nH]c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C12H12F4N6/c13-6-5-4(1-2-20-12(19)22-11(17)18)3-21-10(5)9(16)8(15)7(6)14/h3,21H,1-2H2,(H6,17,18,19,20,22) |
| InChIKey | RSZADDRVDMAULY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|