C11H14FIN4 — CID 111424482
2-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111424482) has the molecular formula C11H14FIN4 and a molecular weight of 348.16 g/mol. Its IUPAC name is 2-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111424482 |
| Molecular Formula | C11H14FIN4 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2-[2-(5-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NCCc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C11H13FN4.HI/c12-8-1-2-10-9(5-8)7(6-16-10)3-4-15-11(13)14;/h1-2,5-6,16H,3-4H2,(H4,13,14,15);1H |
| InChIKey | YNLDHWNLHYNTRP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|